C29H25F3N6O3S — CID 89391756
(1E)-1-[3-(2-butan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 89391756) has the molecular formula C29H25F3N6O3S and a molecular weight of 594.62 g/mol. Its IUPAC name is (1E)-1-[3-(2-butan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | (1E)-1-[3-(2-butan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 89391756 |
| Molecular Formula | C29H25F3N6O3S |
| Molecular Weight | 594.62 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | (1E)-1-[3-(2-butan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | CCC(C)c1ccccc1N1C(=O)CS/C1=N/C(=O)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C29H25F3N6O3S/c1-3-18(2)23-6-4-5-7-24(23)38-25(39)16-42-28(38)35-27(40)34-20-10-8-19(9-11-20)26-33-17-37(36-26)21-12-14-22(15-13-21)41-29(30,31)32/h4-15,17-18H,3,16H2,1-2H3,(H,34,40)/b35-28+ |
| InChIKey | GZSBWUNCYBHRED-AWQADKOQSA-N |
| XLogP | 7.01 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.62 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|