C29H22F6N6O4S — CID 172775881
1-[3-[5-methyl-2-(2,2,2-trifluoro-1-methoxyethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-1-yl]phenyl]urea (PubChem CID 172775881) has the molecular formula C29H22F6N6O4S and a molecular weight of 664.59 g/mol. Its IUPAC name is 1-[3-[5-methyl-2-(2,2,2-trifluoro-1-methoxyethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-1-yl]phenyl]urea.
| Compound Name | 1-[3-[5-methyl-2-(2,2,2-trifluoro-1-methoxyethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 172775881 |
| Molecular Formula | C29H22F6N6O4S |
| Molecular Weight | 664.59 g/mol |
| Exact Mass | 664.13 |
| IUPAC Name | 1-[3-[5-methyl-2-(2,2,2-trifluoro-1-methoxyethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-1-yl]phenyl]urea |
| SMILES | COC(c1ccc(C)cc1N1C(=O)CSC1=NC(=O)Nc1ccc(-n2cnc(-c3ccc(OC(F)(F)F)cc3)n2)cc1)C(F)(F)F |
| InChI | InChI=1S/C29H22F6N6O4S/c1-16-3-12-21(24(44-2)28(30,31)32)22(13-16)41-23(42)14-46-27(41)38-26(43)37-18-6-8-19(9-7-18)40-15-36-25(39-40)17-4-10-20(11-5-17)45-29(33,34)35/h3-13,15,24H,14H2,1-2H3,(H,37,43) |
| InChIKey | NOUVUPMDEAVFLK-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.59 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|