C29H25F3N6O4S — CID 172778870
1-[2-hydroxy-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 172778870) has the molecular formula C29H25F3N6O4S and a molecular weight of 610.62 g/mol. Its IUPAC name is 1-[2-hydroxy-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | 1-[2-hydroxy-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 172778870 |
| Molecular Formula | C29H25F3N6O4S |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | 1-[2-hydroxy-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | Cc1ccc(C(C)C)c(N2C(=O)CSC2=NC(=O)Nc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2O)c1 |
| InChI | InChI=1S/C29H25F3N6O4S/c1-16(2)21-10-4-17(3)12-23(21)38-25(40)14-43-28(38)35-27(41)34-22-11-5-18(13-24(22)39)26-33-15-37(36-26)19-6-8-20(9-7-19)42-29(30,31)32/h4-13,15-16,39H,14H2,1-3H3,(H,34,41) |
| InChIKey | NZDSHJKLQLCMPO-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|