C31H28F3N7O3S — CID 172944558
1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylideneamino]urea (PubChem CID 172944558) has the molecular formula C31H28F3N7O3S and a molecular weight of 635.67 g/mol. Its IUPAC name is 1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylideneamino]urea.
| Compound Name | 1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylideneamino]urea |
|---|---|
| PubChem CID | 172944558 |
| Molecular Formula | C31H28F3N7O3S |
| Molecular Weight | 635.67 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | 1-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylideneamino]urea |
| SMILES | C/C(=N\NC(=O)N=C1SCC(=O)N1c1cc(C)ccc1C(C)C)c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C31H28F3N7O3S/c1-18(2)25-14-5-19(3)15-26(25)41-27(42)16-45-30(41)36-29(43)38-37-20(4)21-6-8-22(9-7-21)28-35-17-40(39-28)23-10-12-24(13-11-23)44-31(32,33)34/h5-15,17-18H,16H2,1-4H3,(H,38,43)/b36-30?,37-20+ |
| InChIKey | JIKVGQLJZSGZMX-HLMTVKRZSA-N |
| XLogP | 6.83 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.67 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|