C31H26F4N6O3S — CID 90438234
(3Z)-1-[(Z)-1-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 90438234) has the molecular formula C31H26F4N6O3S and a molecular weight of 638.65 g/mol. Its IUPAC name is (3Z)-1-[(Z)-1-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[(Z)-1-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 90438234 |
| Molecular Formula | C31H26F4N6O3S |
| Molecular Weight | 638.65 g/mol |
| Exact Mass | 638.17 |
| IUPAC Name | (3Z)-1-[(Z)-1-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | Cc1ccc(C(C)C)c(N2C(=O)CS/C2=N\C(=O)N/C(F)=C/c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C31H26F4N6O3S/c1-18(2)24-13-4-19(3)14-25(24)41-27(42)16-45-30(41)38-29(43)37-26(32)15-20-5-7-21(8-6-20)28-36-17-40(39-28)22-9-11-23(12-10-22)44-31(33,34)35/h4-15,17-18H,16H2,1-3H3,(H,37,43)/b26-15+,38-30- |
| InChIKey | RFKCNTAAXMHXRO-OPSROTMLSA-N |
| XLogP | 7.38 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.65 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|