C30H25F4N7O3S — CID 134413429
(3Z)-1-[(E)-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-3-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 134413429) has the molecular formula C30H25F4N7O3S and a molecular weight of 639.64 g/mol. Its IUPAC name is (3Z)-1-[(E)-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-3-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[(E)-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-3-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 134413429 |
| Molecular Formula | C30H25F4N7O3S |
| Molecular Weight | 639.64 g/mol |
| Exact Mass | 639.17 |
| IUPAC Name | (3Z)-1-[(E)-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-3-[3-(5-methyl-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | Cc1ccc(C(C)C)c(N2C(=O)CS/C2=N\C(=O)N/N=C/c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2F)c1 |
| InChI | InChI=1S/C30H25F4N7O3S/c1-17(2)23-11-4-18(3)12-25(23)41-26(42)15-45-29(41)37-28(43)38-36-14-20-6-5-19(13-24(20)31)27-35-16-40(39-27)21-7-9-22(10-8-21)44-30(32,33)34/h4-14,16-17H,15H2,1-3H3,(H,38,43)/b36-14+,37-29- |
| InChIKey | VZIGDBKDMPTSHD-ITVOTACGSA-N |
| XLogP | 6.58 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.64 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|