C30H26F3N7O3S — CID 134413486
(1Z)-1-[3-(2-butylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea (PubChem CID 134413486) has the molecular formula C30H26F3N7O3S and a molecular weight of 621.65 g/mol. Its IUPAC name is (1Z)-1-[3-(2-butylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea.
| Compound Name | (1Z)-1-[3-(2-butylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 134413486 |
| Molecular Formula | C30H26F3N7O3S |
| Molecular Weight | 621.65 g/mol |
| Exact Mass | 621.18 |
| IUPAC Name | (1Z)-1-[3-(2-butylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea |
| SMILES | CCCCc1ccccc1N1C(=O)CS/C1=N\C(=O)N/N=C/c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C30H26F3N7O3S/c1-2-3-6-21-7-4-5-8-25(21)40-26(41)18-44-29(40)36-28(42)37-35-17-20-9-11-22(12-10-20)27-34-19-39(38-27)23-13-15-24(16-14-23)43-30(31,32)33/h4-5,7-17,19H,2-3,6,18H2,1H3,(H,37,42)/b35-17+,36-29- |
| InChIKey | YRXJHQVBGDTEJN-ZYMBTWIOSA-N |
| XLogP | 6.36 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|