C29H25F3N8O3S — CID 134413559
(1Z)-1-[3-[2-(dimethylamino)-5-methylphenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea (PubChem CID 134413559) has the molecular formula C29H25F3N8O3S and a molecular weight of 622.63 g/mol. Its IUPAC name is (1Z)-1-[3-[2-(dimethylamino)-5-methylphenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea.
| Compound Name | (1Z)-1-[3-[2-(dimethylamino)-5-methylphenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 134413559 |
| Molecular Formula | C29H25F3N8O3S |
| Molecular Weight | 622.63 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | (1Z)-1-[3-[2-(dimethylamino)-5-methylphenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]urea |
| SMILES | Cc1ccc(N(C)C)c(N2C(=O)CS/C2=N\C(=O)N/N=C/c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C29H25F3N8O3S/c1-18-4-13-23(38(2)3)24(14-18)40-25(41)16-44-28(40)35-27(42)36-34-15-19-5-7-20(8-6-19)26-33-17-39(37-26)21-9-11-22(12-10-21)43-29(30,31)32/h4-15,17H,16H2,1-3H3,(H,36,42)/b34-15+,35-28- |
| InChIKey | UKZMIJBCFWXNIX-TUGDVJGSSA-N |
| XLogP | 5.39 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|