C27H21F3N8O2S2 — CID 134413554
(1Z)-1-[3-(2-amino-5-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 134413554) has the molecular formula C27H21F3N8O2S2 and a molecular weight of 610.65 g/mol. Its IUPAC name is (1Z)-1-[3-(2-amino-5-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | (1Z)-1-[3-(2-amino-5-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 134413554 |
| Molecular Formula | C27H21F3N8O2S2 |
| Molecular Weight | 610.65 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | (1Z)-1-[3-(2-amino-5-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | Cc1ccc(N)c(N2C(=O)CS/C2=N\C(=S)N/N=C/c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C27H21F3N8O2S2/c1-16-2-11-21(31)22(12-16)38-23(39)14-42-26(38)34-25(41)35-33-13-17-3-5-18(6-4-17)24-32-15-37(36-24)19-7-9-20(10-8-19)40-27(28,29)30/h2-13,15H,14,31H2,1H3,(H,35,41)/b33-13+,34-26- |
| InChIKey | ODQUDUUKKNLUSR-DGHNOXMNSA-N |
| XLogP | 5.07 |
| TPSA | 123.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.65 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|