C29H24F3N7O3S2 — CID 172961617
1-[3-[2-(1-methoxyethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 172961617) has the molecular formula C29H24F3N7O3S2 and a molecular weight of 639.69 g/mol. Its IUPAC name is 1-[3-[2-(1-methoxyethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-[3-[2-(1-methoxyethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 172961617 |
| Molecular Formula | C29H24F3N7O3S2 |
| Molecular Weight | 639.69 g/mol |
| Exact Mass | 639.13 |
| IUPAC Name | 1-[3-[2-(1-methoxyethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | COC(C)c1ccccc1N1C(=O)CSC1=NC(=S)N/N=C/c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C29H24F3N7O3S2/c1-18(41-2)23-5-3-4-6-24(23)39-25(40)16-44-28(39)35-27(43)36-34-15-19-7-9-20(10-8-19)26-33-17-38(37-26)21-11-13-22(14-12-21)42-29(30,31)32/h3-15,17-18H,16H2,1-2H3,(H,36,43)/b34-15+,35-28? |
| InChIKey | PQORVVAVBNJKIS-CFEKJNOVSA-N |
| XLogP | 5.88 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.69 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|