C29H22F3N7OS2 — CID 172950537
1-(5-methyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 172950537) has the molecular formula C29H22F3N7OS2 and a molecular weight of 605.67 g/mol. Its IUPAC name is 1-(5-methyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-(5-methyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 172950537 |
| Molecular Formula | C29H22F3N7OS2 |
| Molecular Weight | 605.67 g/mol |
| Exact Mass | 605.13 |
| IUPAC Name | 1-(5-methyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | CC1C=C2CSC(=NC(=S)N/N=C/c3ccc(-c4ncn(-c5ccc(OC(F)(F)F)cc5)n4)cc3)N2c2ccccc21 |
| InChI | InChI=1S/C29H22F3N7OS2/c1-18-14-22-16-42-28(39(22)25-5-3-2-4-24(18)25)35-27(41)36-34-15-19-6-8-20(9-7-19)26-33-17-38(37-26)21-10-12-23(13-11-21)40-29(30,31)32/h2-15,17-18H,16H2,1H3,(H,36,41)/b34-15+,35-28? |
| InChIKey | ZYNGDKKLRJTVCF-CFEKJNOVSA-N |
| XLogP | 6.65 |
| TPSA | 79.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.67 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|