C30H25F3N6O4S — CID 163844901
1-(8-methoxy-5-methyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methoxy]urea (PubChem CID 163844901) has the molecular formula C30H25F3N6O4S and a molecular weight of 622.63 g/mol. Its IUPAC name is 1-(8-methoxy-5-methyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methoxy]urea.
| Compound Name | 1-(8-methoxy-5-methyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methoxy]urea |
|---|---|
| PubChem CID | 163844901 |
| Molecular Formula | C30H25F3N6O4S |
| Molecular Weight | 622.63 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | 1-(8-methoxy-5-methyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methoxy]urea |
| SMILES | COc1ccc2c(c1)N1C(=CC2C)CSC1=NC(=O)NOCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C30H25F3N6O4S/c1-18-13-22-16-44-29(39(22)26-14-24(41-2)11-12-25(18)26)35-28(40)37-42-15-19-3-5-20(6-4-19)27-34-17-38(36-27)21-7-9-23(10-8-21)43-30(31,32)33/h3-14,17-18H,15-16H2,1-2H3,(H,37,40) |
| InChIKey | OPGYMNAOFNSIGX-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.63 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|