C31H27F5N6O4S — CID 90438672
(3Z)-1-[1,2-difluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 90438672) has the molecular formula C31H27F5N6O4S and a molecular weight of 674.65 g/mol. Its IUPAC name is (3Z)-1-[1,2-difluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[1,2-difluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 90438672 |
| Molecular Formula | C31H27F5N6O4S |
| Molecular Weight | 674.65 g/mol |
| Exact Mass | 674.17 |
| IUPAC Name | (3Z)-1-[1,2-difluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | COc1ccc(C(C)C)c(N2C(=O)CS/C2=N\C(=O)NC(F)C(F)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C31H27F5N6O4S/c1-17(2)23-13-12-22(45-3)14-24(23)42-25(43)15-47-30(42)39-29(44)38-27(33)26(32)18-4-6-19(7-5-18)28-37-16-41(40-28)20-8-10-21(11-9-20)46-31(34,35)36/h4-14,16-17,26-27H,15H2,1-3H3,(H,38,44)/b39-30- |
| InChIKey | JTAAUBHZPGODLA-RRCMXBARSA-N |
| XLogP | 7.12 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.65 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|