C29H22F6N6O5S — CID 137374360
(1Z)-1-[3-[5-methoxy-2-(2,2,2-trifluoroethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenoxy]methyl]urea (PubChem CID 137374360) has the molecular formula C29H22F6N6O5S and a molecular weight of 680.59 g/mol. Its IUPAC name is (1Z)-1-[3-[5-methoxy-2-(2,2,2-trifluoroethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenoxy]methyl]urea.
| Compound Name | (1Z)-1-[3-[5-methoxy-2-(2,2,2-trifluoroethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenoxy]methyl]urea |
|---|---|
| PubChem CID | 137374360 |
| Molecular Formula | C29H22F6N6O5S |
| Molecular Weight | 680.59 g/mol |
| Exact Mass | 680.13 |
| IUPAC Name | (1Z)-1-[3-[5-methoxy-2-(2,2,2-trifluoroethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenoxy]methyl]urea |
| SMILES | COc1ccc(CC(F)(F)F)c(N2C(=O)CS/C2=N\C(=O)NCOc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C29H22F6N6O5S/c1-44-22-9-4-18(13-28(30,31)32)23(12-22)41-24(42)14-47-27(41)38-26(43)37-16-45-20-7-2-17(3-8-20)25-36-15-40(39-25)19-5-10-21(11-6-19)46-29(33,34)35/h2-12,15H,13-14,16H2,1H3,(H,37,43)/b38-27- |
| InChIKey | XDWYCDKUFJAOMA-SPKJYZRXSA-N |
| XLogP | 6.13 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.59 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|