C31H27F3N6O3S — CID 138722168
(1Z)-1-(5,8-dimethyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethoxy]urea (PubChem CID 138722168) has the molecular formula C31H27F3N6O3S and a molecular weight of 620.66 g/mol. Its IUPAC name is (1Z)-1-(5,8-dimethyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethoxy]urea.
| Compound Name | (1Z)-1-(5,8-dimethyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethoxy]urea |
|---|---|
| PubChem CID | 138722168 |
| Molecular Formula | C31H27F3N6O3S |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | (1Z)-1-(5,8-dimethyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethoxy]urea |
| SMILES | Cc1ccc2c(c1)N1C(=CC2C)CS/C1=N\C(=O)NOC(C)c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C31H27F3N6O3S/c1-18-4-13-26-19(2)15-24-16-44-30(40(24)27(26)14-18)36-29(41)38-43-20(3)21-5-7-22(8-6-21)28-35-17-39(37-28)23-9-11-25(12-10-23)42-31(32,33)34/h4-15,17,19-20H,16H2,1-3H3,(H,38,41)/b36-30- |
| InChIKey | KTYATCTZXIQCNB-BBTNWVSFSA-N |
| XLogP | 7.45 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|