C31H26F3N7OS2 — CID 172950541
1-(5,8-dimethyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[(E)-[2-methyl-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 172950541) has the molecular formula C31H26F3N7OS2 and a molecular weight of 633.73 g/mol. Its IUPAC name is 1-(5,8-dimethyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[(E)-[2-methyl-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-(5,8-dimethyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[(E)-[2-methyl-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 172950541 |
| Molecular Formula | C31H26F3N7OS2 |
| Molecular Weight | 633.73 g/mol |
| Exact Mass | 633.16 |
| IUPAC Name | 1-(5,8-dimethyl-3,5-dihydro-[1,3]thiazolo[3,4-a]quinolin-1-ylidene)-3-[(E)-[2-methyl-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | Cc1ccc2c(c1)N1C(=CC2C)CSC1=NC(=S)N/N=C/c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1C |
| InChI | InChI=1S/C31H26F3N7OS2/c1-18-4-11-26-20(3)14-24-16-44-30(41(24)27(26)12-18)37-29(43)38-36-15-22-6-5-21(13-19(22)2)28-35-17-40(39-28)23-7-9-25(10-8-23)42-31(32,33)34/h4-15,17,20H,16H2,1-3H3,(H,38,43)/b36-15+,37-30? |
| InChIKey | QWQCGNIBKHWQDH-RDHSNDEXSA-N |
| XLogP | 7.27 |
| TPSA | 79.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.73 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|