C29H19F6N7O2S2 — CID 172944634
1-[4-oxo-3-[2-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 172944634) has the molecular formula C29H19F6N7O2S2 and a molecular weight of 675.64 g/mol. Its IUPAC name is 1-[4-oxo-3-[2-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-[4-oxo-3-[2-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 172944634 |
| Molecular Formula | C29H19F6N7O2S2 |
| Molecular Weight | 675.64 g/mol |
| Exact Mass | 675.09 |
| IUPAC Name | 1-[4-oxo-3-[2-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-1,3-thiazolidin-2-ylidene]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | O=C1CSC(=NC(=S)N/N=C/c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)N1c1ccccc1/C=C/C(F)(F)F |
| InChI | InChI=1S/C29H19F6N7O2S2/c30-28(31,32)14-13-19-3-1-2-4-23(19)42-24(43)16-46-27(42)38-26(45)39-37-15-18-5-7-20(8-6-18)25-36-17-41(40-25)21-9-11-22(12-10-21)44-29(33,34)35/h1-15,17H,16H2,(H,39,45)/b14-13+,37-15+,38-27? |
| InChIKey | XPISODPHGLCQKV-OSDDQNLRSA-N |
| XLogP | 6.75 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.64 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|