C32H28F3N7O2S — CID 147728674
1-[(Z)-2-cyano-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazinan-2-ylidene]urea (PubChem CID 147728674) has the molecular formula C32H28F3N7O2S and a molecular weight of 631.68 g/mol. Its IUPAC name is 1-[(Z)-2-cyano-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazinan-2-ylidene]urea.
| Compound Name | 1-[(Z)-2-cyano-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazinan-2-ylidene]urea |
|---|---|
| PubChem CID | 147728674 |
| Molecular Formula | C32H28F3N7O2S |
| Molecular Weight | 631.68 g/mol |
| Exact Mass | 631.20 |
| IUPAC Name | 1-[(Z)-2-cyano-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazinan-2-ylidene]urea |
| SMILES | Cc1cc(C)c(N2CCCSC2=NC(=O)N/C=C(\C#N)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C32H28F3N7O2S/c1-20-15-21(2)28(22(3)16-20)41-13-4-14-45-31(41)39-30(43)37-18-25(17-36)23-5-7-24(8-6-23)29-38-19-42(40-29)26-9-11-27(12-10-26)44-32(33,34)35/h5-12,15-16,18-19H,4,13-14H2,1-3H3,(H,37,43)/b25-18+,39-31? |
| InChIKey | GXZKLUAEGYTRGE-MCFLFQDRSA-N |
| XLogP | 7.33 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.68 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|