C34H37F3N6O2S — CID 90439018
(3Z)-1-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazinan-2-ylidene]urea (PubChem CID 90439018) has the molecular formula C34H37F3N6O2S and a molecular weight of 650.77 g/mol. Its IUPAC name is (3Z)-1-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazinan-2-ylidene]urea.
| Compound Name | (3Z)-1-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazinan-2-ylidene]urea |
|---|---|
| PubChem CID | 90439018 |
| Molecular Formula | C34H37F3N6O2S |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | (3Z)-1-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazinan-2-ylidene]urea |
| SMILES | Cc1cc(C)c(N2CCCS/C2=N\C(=O)NCCCC(C)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C34H37F3N6O2S/c1-22-19-24(3)30(25(4)20-22)42-17-6-18-46-33(42)40-32(44)38-16-5-7-23(2)26-8-10-27(11-9-26)31-39-21-43(41-31)28-12-14-29(15-13-28)45-34(35,36)37/h8-15,19-21,23H,5-7,16-18H2,1-4H3,(H,38,44)/b40-33- |
| InChIKey | JDDKXEDXRLKZNS-WORPLNTISA-N |
| XLogP | 8.35 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|