C33H35F3N6O2S — CID 123503175
1-[3-(2,6-dimethylphenyl)-1,3-thiazinan-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea (PubChem CID 123503175) has the molecular formula C33H35F3N6O2S and a molecular weight of 636.74 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylphenyl)-1,3-thiazinan-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea.
| Compound Name | 1-[3-(2,6-dimethylphenyl)-1,3-thiazinan-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea |
|---|---|
| PubChem CID | 123503175 |
| Molecular Formula | C33H35F3N6O2S |
| Molecular Weight | 636.74 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | 1-[3-(2,6-dimethylphenyl)-1,3-thiazinan-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea |
| SMILES | Cc1cccc(C)c1N1CCCSC1=NC(=O)NCCCC(C)c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C33H35F3N6O2S/c1-22(9-5-18-37-31(43)39-32-41(19-6-20-45-32)29-23(2)7-4-8-24(29)3)25-10-12-26(13-11-25)30-38-21-42(40-30)27-14-16-28(17-15-27)44-33(34,35)36/h4,7-8,10-17,21-22H,5-6,9,18-20H2,1-3H3,(H,37,43) |
| InChIKey | DNXDPEXNMBVKRP-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.74 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|