C33H33F3N6O2S — CID 90439437
(1Z)-1-[3-(2,6-dimethylphenyl)-4-methyl-1,3-thiazol-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea (PubChem CID 90439437) has the molecular formula C33H33F3N6O2S and a molecular weight of 634.73 g/mol. Its IUPAC name is (1Z)-1-[3-(2,6-dimethylphenyl)-4-methyl-1,3-thiazol-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea.
| Compound Name | (1Z)-1-[3-(2,6-dimethylphenyl)-4-methyl-1,3-thiazol-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea |
|---|---|
| PubChem CID | 90439437 |
| Molecular Formula | C33H33F3N6O2S |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | (1Z)-1-[3-(2,6-dimethylphenyl)-4-methyl-1,3-thiazol-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea |
| SMILES | Cc1cccc(C)c1-n1c(C)cs/c1=N\C(=O)NCCCC(C)c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C33H33F3N6O2S/c1-21(9-6-18-37-31(43)39-32-42(24(4)19-45-32)29-22(2)7-5-8-23(29)3)25-10-12-26(13-11-25)30-38-20-41(40-30)27-14-16-28(17-15-27)44-33(34,35)36/h5,7-8,10-17,19-21H,6,9,18H2,1-4H3,(H,37,43)/b39-32- |
| InChIKey | DIKINXVACRNUDV-IJGATTDUSA-N |
| XLogP | 7.80 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|