C32H31F3N6O2S — CID 123244516
1-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea (PubChem CID 123244516) has the molecular formula C32H31F3N6O2S and a molecular weight of 620.70 g/mol. Its IUPAC name is 1-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea.
| Compound Name | 1-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea |
|---|---|
| PubChem CID | 123244516 |
| Molecular Formula | C32H31F3N6O2S |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | 1-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea |
| SMILES | Cc1cc(C)c(-n2c(C)csc2=NC(=O)NCC(C)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C32H31F3N6O2S/c1-19-14-20(2)28(21(3)15-19)41-23(5)17-44-31(41)38-30(42)36-16-22(4)24-6-8-25(9-7-24)29-37-18-40(39-29)26-10-12-27(13-11-26)43-32(33,34)35/h6-15,17-18,22H,16H2,1-5H3,(H,36,42) |
| InChIKey | MCOIHIPQBVIZCK-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|