C31H28F4N6O2S — CID 123357951
1-[2-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]urea (PubChem CID 123357951) has the molecular formula C31H28F4N6O2S and a molecular weight of 624.66 g/mol. Its IUPAC name is 1-[2-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]urea.
| Compound Name | 1-[2-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]urea |
|---|---|
| PubChem CID | 123357951 |
| Molecular Formula | C31H28F4N6O2S |
| Molecular Weight | 624.66 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | 1-[2-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]urea |
| SMILES | Cc1cc(C)c(-n2c(C)csc2=NC(=O)NCC(F)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C31H28F4N6O2S/c1-18-13-19(2)27(20(3)14-18)41-21(4)16-44-30(41)38-29(42)36-15-26(32)22-5-7-23(8-6-22)28-37-17-40(39-28)24-9-11-25(12-10-24)43-31(33,34)35/h5-14,16-17,26H,15H2,1-4H3,(H,36,42) |
| InChIKey | WWTQAXXPBFHRKF-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.66 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|