C33H30F3N5O2S — CID 147232734
N-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]-2-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]acetamide (PubChem CID 147232734) has the molecular formula C33H30F3N5O2S and a molecular weight of 617.70 g/mol. Its IUPAC name is N-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]-2-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]acetamide.
| Compound Name | N-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]-2-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]acetamide |
|---|---|
| PubChem CID | 147232734 |
| Molecular Formula | C33H30F3N5O2S |
| Molecular Weight | 617.70 g/mol |
| Exact Mass | 617.21 |
| IUPAC Name | N-[4-methyl-3-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]-2-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]acetamide |
| SMILES | Cc1cc(C)c(-n2c(C)cs/c2=N\C(=O)CC2CC2c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C33H30F3N5O2S/c1-19-13-20(2)30(21(3)14-19)41-22(4)17-44-32(41)38-29(42)16-25-15-28(25)23-5-7-24(8-6-23)31-37-18-40(39-31)26-9-11-27(12-10-26)43-33(34,35)36/h5-14,17-18,25,28H,15-16H2,1-4H3/b38-32- |
| InChIKey | CJFRZYOHVVYKOK-IFZQRFIDSA-N |
| XLogP | 7.54 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.70 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|