C34H37F3N6O2S — CID 123649336
1-[3-(2-ethylphenyl)-4-methyl-1,3-thiazinan-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea (PubChem CID 123649336) has the molecular formula C34H37F3N6O2S and a molecular weight of 650.77 g/mol. Its IUPAC name is 1-[3-(2-ethylphenyl)-4-methyl-1,3-thiazinan-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea.
| Compound Name | 1-[3-(2-ethylphenyl)-4-methyl-1,3-thiazinan-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea |
|---|---|
| PubChem CID | 123649336 |
| Molecular Formula | C34H37F3N6O2S |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | 1-[3-(2-ethylphenyl)-4-methyl-1,3-thiazinan-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea |
| SMILES | CCc1ccccc1N1C(=NC(=O)NCCCC(C)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)SCCC1C |
| InChI | InChI=1S/C34H37F3N6O2S/c1-4-25-9-5-6-10-30(25)43-24(3)19-21-46-33(43)40-32(44)38-20-7-8-23(2)26-11-13-27(14-12-26)31-39-22-42(41-31)28-15-17-29(18-16-28)45-34(35,36)37/h5-6,9-18,22-24H,4,7-8,19-21H2,1-3H3,(H,38,44) |
| InChIKey | ZUZYFBIJBWRNPI-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|