C36H41F3N6O2S — CID 159516206
1-[4-methyl-3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazinan-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea (PubChem CID 159516206) has the molecular formula C36H41F3N6O2S and a molecular weight of 678.83 g/mol. Its IUPAC name is 1-[4-methyl-3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazinan-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea.
| Compound Name | 1-[4-methyl-3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazinan-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea |
|---|---|
| PubChem CID | 159516206 |
| Molecular Formula | C36H41F3N6O2S |
| Molecular Weight | 678.83 g/mol |
| Exact Mass | 678.30 |
| IUPAC Name | 1-[4-methyl-3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazinan-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea |
| SMILES | Cc1ccc(C(C)C)c(N2C(=NC(=O)NCCCC(C)c3ccc(-c4ncn(-c5ccc(OC(F)(F)F)cc5)n4)cc3)SCCC2C)c1 |
| InChI | InChI=1S/C36H41F3N6O2S/c1-23(2)31-17-8-24(3)21-32(31)45-26(5)18-20-48-35(45)42-34(46)40-19-6-7-25(4)27-9-11-28(12-10-27)33-41-22-44(43-33)29-13-15-30(16-14-29)47-36(37,38)39/h8-17,21-23,25-26H,6-7,18-20H2,1-5H3,(H,40,46) |
| InChIKey | MBFNXABGWXRGNM-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.83 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|