C31H26F3N7O2S — CID 90439419
(3Z)-1-[(Z)-2-cyano-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2,6-dimethylphenyl)-1,3-thiazinan-2-ylidene]urea (PubChem CID 90439419) has the molecular formula C31H26F3N7O2S and a molecular weight of 617.66 g/mol. Its IUPAC name is (3Z)-1-[(Z)-2-cyano-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2,6-dimethylphenyl)-1,3-thiazinan-2-ylidene]urea.
| Compound Name | (3Z)-1-[(Z)-2-cyano-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2,6-dimethylphenyl)-1,3-thiazinan-2-ylidene]urea |
|---|---|
| PubChem CID | 90439419 |
| Molecular Formula | C31H26F3N7O2S |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.18 |
| IUPAC Name | (3Z)-1-[(Z)-2-cyano-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2,6-dimethylphenyl)-1,3-thiazinan-2-ylidene]urea |
| SMILES | Cc1cccc(C)c1N1CCCS/C1=N\C(=O)N/C=C(\C#N)c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C31H26F3N7O2S/c1-20-5-3-6-21(2)27(20)40-15-4-16-44-30(40)38-29(42)36-18-24(17-35)22-7-9-23(10-8-22)28-37-19-41(39-28)25-11-13-26(14-12-25)43-31(32,33)34/h3,5-14,18-19H,4,15-16H2,1-2H3,(H,36,42)/b24-18+,38-30- |
| InChIKey | ILUDIDBCHHDHIE-ZBLVAYEASA-N |
| XLogP | 7.02 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|