C30H26F4N6O2S — CID 90438999
(3Z)-1-[(Z)-2-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea (PubChem CID 90438999) has the molecular formula C30H26F4N6O2S and a molecular weight of 610.64 g/mol. Its IUPAC name is (3Z)-1-[(Z)-2-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[(Z)-2-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 90438999 |
| Molecular Formula | C30H26F4N6O2S |
| Molecular Weight | 610.64 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | (3Z)-1-[(Z)-2-fluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethenyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea |
| SMILES | Cc1cc(C)c(N2CCS/C2=N\C(=O)N/C=C(\F)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C30H26F4N6O2S/c1-18-14-19(2)26(20(3)15-18)39-12-13-43-29(39)37-28(41)35-16-25(31)21-4-6-22(7-5-21)27-36-17-40(38-27)23-8-10-24(11-9-23)42-30(32,33)34/h4-11,14-17H,12-13H2,1-3H3,(H,35,41)/b25-16-,37-29- |
| InChIKey | FBMHIQOTSFHSGO-VCCCXHDPSA-N |
| XLogP | 7.35 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.64 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|