C31H29F3N6O2S — CID 123138227
1-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea (PubChem CID 123138227) has the molecular formula C31H29F3N6O2S and a molecular weight of 606.67 g/mol. Its IUPAC name is 1-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | 1-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 123138227 |
| Molecular Formula | C31H29F3N6O2S |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | 1-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopropyl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea |
| SMILES | Cc1cc(C)c(N2CCSC2=NC(=O)NC2(c3ccc(-c4ncn(-c5ccc(OC(F)(F)F)cc5)n4)cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C31H29F3N6O2S/c1-19-16-20(2)26(21(3)17-19)39-14-15-43-29(39)36-28(41)37-30(12-13-30)23-6-4-22(5-7-23)27-35-18-40(38-27)24-8-10-25(11-9-24)42-31(32,33)34/h4-11,16-18H,12-15H2,1-3H3,(H,37,41) |
| InChIKey | SYYOVUOMWGEBJV-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|