C31H31F3N6O2S — CID 154046455
1-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propan-2-yl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea (PubChem CID 154046455) has the molecular formula C31H31F3N6O2S and a molecular weight of 608.69 g/mol. Its IUPAC name is 1-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propan-2-yl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | 1-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propan-2-yl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 154046455 |
| Molecular Formula | C31H31F3N6O2S |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | 1-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propan-2-yl]-3-[3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-2-ylidene]urea |
| SMILES | Cc1cc(C)c(N2CCSC2=NC(=O)NC(C)(C)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C31H31F3N6O2S/c1-19-16-20(2)26(21(3)17-19)39-14-15-43-29(39)36-28(41)37-30(4,5)23-8-6-22(7-9-23)27-35-18-40(38-27)24-10-12-25(13-11-24)42-31(32,33)34/h6-13,16-18H,14-15H2,1-5H3,(H,37,41) |
| InChIKey | YHHCLCXIAYLONR-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|