C31H29F3N6O4S — CID 131990382
(1Z)-1-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea (PubChem CID 131990382) has the molecular formula C31H29F3N6O4S and a molecular weight of 638.67 g/mol. Its IUPAC name is (1Z)-1-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea.
| Compound Name | (1Z)-1-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea |
|---|---|
| PubChem CID | 131990382 |
| Molecular Formula | C31H29F3N6O4S |
| Molecular Weight | 638.67 g/mol |
| Exact Mass | 638.19 |
| IUPAC Name | (1Z)-1-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]pentyl]urea |
| SMILES | COc1ccc(N2C(=O)CS/C2=N\C(=O)NCCCC(C)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C31H29F3N6O4S/c1-20(4-3-17-35-29(42)37-30-40(27(41)18-45-30)24-11-13-25(43-2)14-12-24)21-5-7-22(8-6-21)28-36-19-39(38-28)23-9-15-26(16-10-23)44-31(32,33)34/h5-16,19-20H,3-4,17-18H2,1-2H3,(H,35,42)/b37-30- |
| InChIKey | JVQSSNLYEBHWKY-ONQIKCEGSA-N |
| XLogP | 6.57 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.67 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|