C39H36F3N7O5S — CID 154036528
benzyl N-[1-[[3-(2-ethyl-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamoylamino]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]carbamate (PubChem CID 154036528) has the molecular formula C39H36F3N7O5S and a molecular weight of 771.82 g/mol. Its IUPAC name is benzyl N-[1-[[3-(2-ethyl-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamoylamino]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]carbamate.
| Compound Name | benzyl N-[1-[[3-(2-ethyl-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamoylamino]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 154036528 |
| Molecular Formula | C39H36F3N7O5S |
| Molecular Weight | 771.82 g/mol |
| Exact Mass | 771.25 |
| IUPAC Name | benzyl N-[1-[[3-(2-ethyl-6-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]carbamoylamino]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]carbamate |
| SMILES | CCc1cccc(C)c1N1C(=O)CSC1=NC(=O)NC(CCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C39H36F3N7O5S/c1-3-28-11-7-8-25(2)34(28)49-33(50)23-55-37(49)46-36(51)44-32(45-38(52)53-22-27-9-5-4-6-10-27)21-14-26-12-15-29(16-13-26)35-43-24-48(47-35)30-17-19-31(20-18-30)54-39(40,41)42/h4-13,15-20,24,32H,3,14,21-23H2,1-2H3,(H,44,51)(H,45,52) |
| InChIKey | GXKUYCSBGAFQHS-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 140.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.82 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|