C30H26F5N7O3S2 — CID 138722194
(1Z)-1-[3-[2-(methoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylamino]thiourea (PubChem CID 138722194) has the molecular formula C30H26F5N7O3S2 and a molecular weight of 691.71 g/mol. Its IUPAC name is (1Z)-1-[3-[2-(methoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylamino]thiourea.
| Compound Name | (1Z)-1-[3-[2-(methoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylamino]thiourea |
|---|---|
| PubChem CID | 138722194 |
| Molecular Formula | C30H26F5N7O3S2 |
| Molecular Weight | 691.71 g/mol |
| Exact Mass | 691.15 |
| IUPAC Name | (1Z)-1-[3-[2-(methoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylamino]thiourea |
| SMILES | COCc1ccccc1N1C(=O)CS/C1=N\C(=S)NNC(C)c1ccc(-c2ncn(-c3ccc(OC(F)(F)C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C30H26F5N7O3S2/c1-18(38-39-27(46)37-28-42(25(43)16-47-28)24-6-4-3-5-21(24)15-44-2)19-7-9-20(10-8-19)26-36-17-41(40-26)22-11-13-23(14-12-22)45-30(34,35)29(31,32)33/h3-14,17-18,38H,15-16H2,1-2H3,(H,39,46)/b37-28- |
| InChIKey | CMVZETVEGYGDNE-FSUXQIQLSA-N |
| XLogP | 6.19 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.71 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|