C28H21F3N6O2S2 — CID 134413395
(2Z)-2-[3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-[(E)-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]ethanethioamide (PubChem CID 134413395) has the molecular formula C28H21F3N6O2S2 and a molecular weight of 594.64 g/mol. Its IUPAC name is (2Z)-2-[3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-[(E)-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]ethanethioamide.
| Compound Name | (2Z)-2-[3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-[(E)-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]ethanethioamide |
|---|---|
| PubChem CID | 134413395 |
| Molecular Formula | C28H21F3N6O2S2 |
| Molecular Weight | 594.64 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | (2Z)-2-[3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-[(E)-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]ethanethioamide |
| SMILES | Cc1ccccc1N1C(=O)CS/C1=C\C(=S)N/N=C/c1cccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C28H21F3N6O2S2/c1-18-5-2-3-8-23(18)37-25(38)16-41-26(37)14-24(40)34-33-15-19-6-4-7-20(13-19)27-32-17-36(35-27)21-9-11-22(12-10-21)39-28(29,30)31/h2-15,17H,16H2,1H3,(H,34,40)/b26-14-,33-15+ |
| InChIKey | QCJKMJBOOBKUJN-IEOCYYKISA-N |
| XLogP | 6.01 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.64 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|