C29H25F3N6O4S — CID 88853798
(2Z)-3-(2,6-diethoxyphenyl)-2-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 88853798) has the molecular formula C29H25F3N6O4S and a molecular weight of 610.62 g/mol. Its IUPAC name is (2Z)-3-(2,6-diethoxyphenyl)-2-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-3-(2,6-diethoxyphenyl)-2-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 88853798 |
| Molecular Formula | C29H25F3N6O4S |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | (2Z)-3-(2,6-diethoxyphenyl)-2-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CCOc1cccc(OCC)c1N1C(=O)CS/C1=N\N=C\c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C29H25F3N6O4S/c1-3-40-23-6-5-7-24(41-4-2)26(23)38-25(39)17-43-28(38)35-34-16-19-8-10-20(11-9-19)27-33-18-37(36-27)21-12-14-22(15-13-21)42-29(30,31)32/h5-16,18H,3-4,17H2,1-2H3/b34-16+,35-28- |
| InChIKey | FVUPXBSCAXSYPM-YYRQEJHOSA-N |
| XLogP | 6.10 |
| TPSA | 103.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|