C27H23F3N6O2S — CID 88853840
(E)-3-(2-ethoxyphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-1,3-thiazolidin-2-imine (PubChem CID 88853840) has the molecular formula C27H23F3N6O2S and a molecular weight of 552.58 g/mol. Its IUPAC name is (E)-3-(2-ethoxyphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-1,3-thiazolidin-2-imine.
| Compound Name | (E)-3-(2-ethoxyphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 88853840 |
| Molecular Formula | C27H23F3N6O2S |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | (E)-3-(2-ethoxyphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-1,3-thiazolidin-2-imine |
| SMILES | CCOc1ccccc1N1CCS/C1=N\N=C\c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C27H23F3N6O2S/c1-2-37-24-6-4-3-5-23(24)35-15-16-39-26(35)33-32-17-19-7-9-20(10-8-19)25-31-18-36(34-25)21-11-13-22(14-12-21)38-27(28,29)30/h3-14,17-18H,2,15-16H2,1H3/b32-17+,33-26- |
| InChIKey | RCTATUXBEIGUGY-ZIHOTGLPSA-N |
| XLogP | 6.17 |
| TPSA | 77.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|