C28H25F3N6O2S — CID 123831113
3-(2-ethylphenyl)-4-methyl-2-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-ol (PubChem CID 123831113) has the molecular formula C28H25F3N6O2S and a molecular weight of 566.61 g/mol. Its IUPAC name is 3-(2-ethylphenyl)-4-methyl-2-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-ol.
| Compound Name | 3-(2-ethylphenyl)-4-methyl-2-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-ol |
|---|---|
| PubChem CID | 123831113 |
| Molecular Formula | C28H25F3N6O2S |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | 3-(2-ethylphenyl)-4-methyl-2-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-ol |
| SMILES | CCc1ccccc1N1C(=NN=Cc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)SCC1(C)O |
| InChI | InChI=1S/C28H25F3N6O2S/c1-3-20-6-4-5-7-24(20)37-26(40-17-27(37,2)38)34-33-16-19-8-10-21(11-9-19)25-32-18-36(35-25)22-12-14-23(15-13-22)39-28(29,30)31/h4-16,18,38H,3,17H2,1-2H3 |
| InChIKey | RFLLGDRZKLPPKJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|