C29H29F3N6OS — CID 159975205
(Z)-N-[(Z)-[2-(2,6-dimethylphenyl)thiazepan-1-ylidene]amino]-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methanimine (PubChem CID 159975205) has the molecular formula C29H29F3N6OS and a molecular weight of 566.65 g/mol. Its IUPAC name is (Z)-N-[(Z)-[2-(2,6-dimethylphenyl)thiazepan-1-ylidene]amino]-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methanimine.
| Compound Name | (Z)-N-[(Z)-[2-(2,6-dimethylphenyl)thiazepan-1-ylidene]amino]-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methanimine |
|---|---|
| PubChem CID | 159975205 |
| Molecular Formula | C29H29F3N6OS |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | (Z)-N-[(Z)-[2-(2,6-dimethylphenyl)thiazepan-1-ylidene]amino]-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methanimine |
| SMILES | Cc1cccc(C)c1N1CCCCC/S1=N/N=C\c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C29H29F3N6OS/c1-21-7-6-8-22(2)27(21)38-17-4-3-5-18-40(38)36-34-19-23-9-11-24(12-10-23)28-33-20-37(35-28)25-13-15-26(16-14-25)39-29(30,31)32/h6-16,19-20H,3-5,17-18H2,1-2H3/b34-19- |
| InChIKey | OFBHNEKLNTZVFJ-FZKWRIDDSA-N |
| XLogP | 7.19 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|