C27H17ClF6N6OS — CID 123148602
3-[2-chloro-6-(trifluoromethyl)phenyl]-4-methyl-N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-1,3-thiazol-2-imine (PubChem CID 123148602) has the molecular formula C27H17ClF6N6OS and a molecular weight of 622.98 g/mol. Its IUPAC name is 3-[2-chloro-6-(trifluoromethyl)phenyl]-4-methyl-N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 3-[2-chloro-6-(trifluoromethyl)phenyl]-4-methyl-N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 123148602 |
| Molecular Formula | C27H17ClF6N6OS |
| Molecular Weight | 622.98 g/mol |
| Exact Mass | 622.08 |
| IUPAC Name | 3-[2-chloro-6-(trifluoromethyl)phenyl]-4-methyl-N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-1,3-thiazol-2-imine |
| SMILES | Cc1csc(=NN=Cc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)n1-c1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C27H17ClF6N6OS/c1-16-14-42-25(40(16)23-21(26(29,30)31)3-2-4-22(23)28)37-36-13-17-5-7-18(8-6-17)24-35-15-39(38-24)19-9-11-20(12-10-19)41-27(32,33)34/h2-15H,1H3 |
| InChIKey | YIRZXUHIUVPEHE-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.98 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|