C26H17BrF3N5OS — CID 121389123
1-(2-bromophenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea (PubChem CID 121389123) has the molecular formula C26H17BrF3N5OS and a molecular weight of 584.42 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea.
| Compound Name | 1-(2-bromophenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 121389123 |
| Molecular Formula | C26H17BrF3N5OS |
| Molecular Weight | 584.42 g/mol |
| Exact Mass | 583.03 |
| IUPAC Name | 1-(2-bromophenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea |
| SMILES | FC(F)(F)Oc1ccc(-n2cnc3c4ccc(/C=N/NC(=S)Nc5ccccc5Br)cc4ccc32)cc1 |
| InChI | InChI=1S/C26H17BrF3N5OS/c27-21-3-1-2-4-22(21)33-25(37)34-32-14-16-5-11-20-17(13-16)6-12-23-24(20)31-15-35(23)18-7-9-19(10-8-18)36-26(28,29)30/h1-15H,(H2,33,34,37)/b32-14+ |
| InChIKey | ZVWGVEZHCCIYCC-HIWRWHBISA-N |
| XLogP | 7.16 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.42 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|