C27H25F3N6OS — CID 142606633
1-[(E)-[1-methyl-3-[[4-(trifluoromethoxy)phenyl]iminomethyl]indazol-6-yl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea (PubChem CID 142606633) has the molecular formula C27H25F3N6OS and a molecular weight of 538.60 g/mol. Its IUPAC name is 1-[(E)-[1-methyl-3-[[4-(trifluoromethoxy)phenyl]iminomethyl]indazol-6-yl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[(E)-[1-methyl-3-[[4-(trifluoromethoxy)phenyl]iminomethyl]indazol-6-yl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 142606633 |
| Molecular Formula | C27H25F3N6OS |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 1-[(E)-[1-methyl-3-[[4-(trifluoromethoxy)phenyl]iminomethyl]indazol-6-yl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)c1ccccc1NC(=S)N/N=C/c1ccc2c(/C=N/c3ccc(OC(F)(F)F)cc3)nn(C)c2c1 |
| InChI | InChI=1S/C27H25F3N6OS/c1-17(2)21-6-4-5-7-23(21)33-26(38)34-32-15-18-8-13-22-24(35-36(3)25(22)14-18)16-31-19-9-11-20(12-10-19)37-27(28,29)30/h4-17H,1-3H3,(H2,33,34,38)/b31-16+,32-15+ |
| InChIKey | IOCFSBRLWULURG-VLHQDKFASA-N |
| XLogP | 6.67 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|