C25H27F3N6O2S — CID 135122650
1-[(E)-2-[6-[N-methyl-4-(trifluoromethoxy)anilino]pyridazin-3-yl]oxypropylideneamino]-3-(2-propan-2-ylphenyl)thiourea (PubChem CID 135122650) has the molecular formula C25H27F3N6O2S and a molecular weight of 532.59 g/mol. Its IUPAC name is 1-[(E)-2-[6-[N-methyl-4-(trifluoromethoxy)anilino]pyridazin-3-yl]oxypropylideneamino]-3-(2-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[(E)-2-[6-[N-methyl-4-(trifluoromethoxy)anilino]pyridazin-3-yl]oxypropylideneamino]-3-(2-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 135122650 |
| Molecular Formula | C25H27F3N6O2S |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 1-[(E)-2-[6-[N-methyl-4-(trifluoromethoxy)anilino]pyridazin-3-yl]oxypropylideneamino]-3-(2-propan-2-ylphenyl)thiourea |
| SMILES | CC(/C=N/NC(=S)Nc1ccccc1C(C)C)Oc1ccc(N(C)c2ccc(OC(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C25H27F3N6O2S/c1-16(2)20-7-5-6-8-21(20)30-24(37)33-29-15-17(3)35-23-14-13-22(31-32-23)34(4)18-9-11-19(12-10-18)36-25(26,27)28/h5-17H,1-4H3,(H2,30,33,37)/b29-15+ |
| InChIKey | FHUSEBMZCONAQE-WKULSOCRSA-N |
| XLogP | 6.01 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|