C24H26F3N5O2S — CID 155720879
1-(2-propan-2-ylphenyl)-3-[3-[(E)-2-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]ethenoxy]propyl]thiourea (PubChem CID 155720879) has the molecular formula C24H26F3N5O2S and a molecular weight of 505.57 g/mol. Its IUPAC name is 1-(2-propan-2-ylphenyl)-3-[3-[(E)-2-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]ethenoxy]propyl]thiourea.
| Compound Name | 1-(2-propan-2-ylphenyl)-3-[3-[(E)-2-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]ethenoxy]propyl]thiourea |
|---|---|
| PubChem CID | 155720879 |
| Molecular Formula | C24H26F3N5O2S |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 1-(2-propan-2-ylphenyl)-3-[3-[(E)-2-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]ethenoxy]propyl]thiourea |
| SMILES | CC(C)c1ccccc1NC(=S)NCCCO/C=C/c1ncn(-c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C24H26F3N5O2S/c1-17(2)20-6-3-4-7-21(20)30-23(35)28-13-5-14-33-15-12-22-29-16-32(31-22)18-8-10-19(11-9-18)34-24(25,26)27/h3-4,6-12,15-17H,5,13-14H2,1-2H3,(H2,28,30,35)/b15-12+ |
| InChIKey | CSQNZTXXMAKTSN-NTCAYCPXSA-N |
| XLogP | 5.65 |
| TPSA | 73.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|