C29H30F3N7OS — CID 167212044
1-[[4-[5-(cyclopropylamino)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylamino]-3-(2-propan-2-ylphenyl)thiourea (PubChem CID 167212044) has the molecular formula C29H30F3N7OS and a molecular weight of 581.67 g/mol. Its IUPAC name is 1-[[4-[5-(cyclopropylamino)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylamino]-3-(2-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[[4-[5-(cyclopropylamino)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylamino]-3-(2-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 167212044 |
| Molecular Formula | C29H30F3N7OS |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | 1-[[4-[5-(cyclopropylamino)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylamino]-3-(2-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)c1ccccc1NC(=S)NNCc1ccc(-c2nc(NC3CC3)n(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C29H30F3N7OS/c1-18(2)24-5-3-4-6-25(24)35-28(41)37-33-17-19-7-9-20(10-8-19)26-36-27(34-21-11-12-21)39(38-26)22-13-15-23(16-14-22)40-29(30,31)32/h3-10,13-16,18,21,33H,11-12,17H2,1-2H3,(H,34,36,38)(H2,35,37,41) |
| InChIKey | VOGXEQPVVOTCEE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|