C26H26F3N7OS — CID 167211720
1-[[4-[5-amino-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylamino]-3-(2-propan-2-ylphenyl)thiourea (PubChem CID 167211720) has the molecular formula C26H26F3N7OS and a molecular weight of 541.60 g/mol. Its IUPAC name is 1-[[4-[5-amino-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylamino]-3-(2-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[[4-[5-amino-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylamino]-3-(2-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 167211720 |
| Molecular Formula | C26H26F3N7OS |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 1-[[4-[5-amino-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylamino]-3-(2-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)c1ccccc1NC(=S)NNCc1ccc(-c2nc(N)n(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C26H26F3N7OS/c1-16(2)21-5-3-4-6-22(21)32-25(38)34-31-15-17-7-9-18(10-8-17)23-33-24(30)36(35-23)19-11-13-20(14-12-19)37-26(27,28)29/h3-14,16,31H,15H2,1-2H3,(H2,30,33,35)(H2,32,34,38) |
| InChIKey | NQRBWVRHGPTTTJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|