C27H24F5N5O2 — CID 118675038
1-[[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]-3-(2-propan-2-ylphenyl)urea (PubChem CID 118675038) has the molecular formula C27H24F5N5O2 and a molecular weight of 545.51 g/mol. Its IUPAC name is 1-[[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]-3-(2-propan-2-ylphenyl)urea.
| Compound Name | 1-[[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]-3-(2-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 118675038 |
| Molecular Formula | C27H24F5N5O2 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 1-[[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]-3-(2-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccccc1NC(=O)NCc1ccc(-c2ncn(-c3ccc(OC(F)(F)C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C27H24F5N5O2/c1-17(2)22-5-3-4-6-23(22)35-25(38)33-15-18-7-9-19(10-8-18)24-34-16-37(36-24)20-11-13-21(14-12-20)39-27(31,32)26(28,29)30/h3-14,16-17H,15H2,1-2H3,(H2,33,35,38) |
| InChIKey | ISRQPCDMYMAQSX-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|