C17H11F5N4O3 — CID 87430418
[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamic acid (PubChem CID 87430418) has the molecular formula C17H11F5N4O3 and a molecular weight of 414.29 g/mol. Its IUPAC name is [4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamic acid.
| Compound Name | [4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 87430418 |
| Molecular Formula | C17H11F5N4O3 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | [4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C17H11F5N4O3/c18-16(19,20)17(21,22)29-13-7-5-12(6-8-13)26-9-23-14(25-26)10-1-3-11(4-2-10)24-15(27)28/h1-9,24H,(H,27,28) |
| InChIKey | QJIQBARAAVCECQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|