C20H14F5N3O5 — CID 118652313
ethoxycarbonyl 4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]benzoate (PubChem CID 118652313) has the molecular formula C20H14F5N3O5 and a molecular weight of 471.34 g/mol. Its IUPAC name is ethoxycarbonyl 4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]benzoate.
| Compound Name | ethoxycarbonyl 4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]benzoate |
|---|---|
| PubChem CID | 118652313 |
| Molecular Formula | C20H14F5N3O5 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | ethoxycarbonyl 4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]benzoate |
| SMILES | CCOC(=O)OC(=O)c1ccc(-c2ncn(-c3ccc(OC(F)(F)C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C20H14F5N3O5/c1-2-31-18(30)32-17(29)13-5-3-12(4-6-13)16-26-11-28(27-16)14-7-9-15(10-8-14)33-20(24,25)19(21,22)23/h3-11H,2H2,1H3 |
| InChIKey | JQRDQAKDSMCXAD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|