C21H15F3N4O3 — CID 90443033
ethyl (E)-2-cyano-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-2-enoate (PubChem CID 90443033) has the molecular formula C21H15F3N4O3 and a molecular weight of 428.37 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 90443033 |
| Molecular Formula | C21H15F3N4O3 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | ethyl (E)-2-cyano-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C21H15F3N4O3/c1-2-30-20(29)16(12-25)11-14-3-5-15(6-4-14)19-26-13-28(27-19)17-7-9-18(10-8-17)31-21(22,23)24/h3-11,13H,2H2,1H3/b16-11+ |
| InChIKey | IMBFOQBILVXEAZ-LFIBNONCSA-N |
| XLogP | 4.30 |
| TPSA | 90.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|