C19H11F3N4O3 — CID 153251222
(E)-2-cyano-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-2-enoic acid (PubChem CID 153251222) has the molecular formula C19H11F3N4O3 and a molecular weight of 400.32 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 153251222 |
| Molecular Formula | C19H11F3N4O3 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | (E)-2-cyano-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)C(=O)O |
| InChI | InChI=1S/C19H11F3N4O3/c20-19(21,22)29-16-7-5-15(6-8-16)26-11-24-17(25-26)13-3-1-12(2-4-13)9-14(10-23)18(27)28/h1-9,11H,(H,27,28)/b14-9+ |
| InChIKey | WTJHNSIEQSOFKX-NTEUORMPSA-N |
| XLogP | 3.82 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|